CAS 98476-15-4

Ethyl 5-cyano-1-(4-pyridinyl)-1H-pyrazole-4-carboxylate

Description:

Ethyl 5-cyano-1-(4-pyridinyl)-1H-pyrazole-4-carboxylate, with the CAS number 98476-15-4, is a chemical compound characterized by its pyrazole core, which is substituted with a cyano group and a pyridine ring. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the pyridine moiety, which is known for its role in various pharmacological applications. The ethyl ester functional group contributes to its solubility in organic solvents, making it suitable for various synthetic applications. The presence of the cyano group may enhance its reactivity, allowing for further chemical modifications. Additionally, compounds like this one are often investigated for their potential use in agrochemicals, pharmaceuticals, or as intermediates in organic synthesis. Its structural features suggest that it may participate in hydrogen bonding and other intermolecular interactions, influencing its physical and chemical properties. Overall, this compound represents a versatile structure in the realm of organic chemistry.

Formula: C₁₂H₁₀N₄O₂

InChI: InChI=1S/C12H10N4O2/c1-2-18-12(17)10-8-15-16(11(10)7-13)9-3-5-14-6-4-9/h3-6,8H,2H2,1H3

InChI key: InChIKey=ITOJQBVQHMPFHX-UHFFFAOYSA-N

SMILES: C(#N)C=1N(N=CC1C(OCC)=O)C=2C=CN=CC2

Synonyms:

• 1H-Pyrazole-4-carboxylic acid, 5-cyano-1-(4-pyridinyl)-, ethyl ester
• Ethyl 5-cyano-1-(4-pyridinyl)-1H-pyrazole-4-carboxylate

Ethyl 5-cyano-1-(pyridin-4-yl)-1H-pyrazole-4-carboxylate

CAS: 98476-15-4

Formula: C₁₂H₁₀N₄O₂

Molecular weight: 242.2334

Ref: IN-DA00IK3P