CymitQuimica logo

CAS 98480-32-1

:

1-(1,3-Benzodioxol-5-yl)cyclopropanemethanol

Description:
1-(1,3-Benzodioxol-5-yl)cyclopropanemethanol, with the CAS number 98480-32-1, is a chemical compound characterized by its unique structural features, which include a cyclopropane ring and a benzodioxole moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the benzodioxole group often imparts interesting electronic properties, making it a subject of interest in various chemical and pharmaceutical applications. The hydroxymethyl group (-CH2OH) attached to the cyclopropane enhances its solubility in polar solvents and may influence its biological activity. Additionally, the compound may exhibit chirality due to the cyclopropane structure, leading to potential stereoisomerism. Its synthesis and characterization are of interest in organic chemistry, particularly in the development of novel compounds for medicinal chemistry. Overall, this compound's unique structure and functional groups suggest potential applications in drug development and materials science.
Formula:C11H12O3
InChI:InChI=1S/C11H12O3/c12-6-11(3-4-11)8-1-2-9-10(5-8)14-7-13-9/h1-2,5,12H,3-4,6-7H2
InChI key:InChIKey=KHNFUXRLTPBMCC-UHFFFAOYSA-N
SMILES:C(O)C1(CC1)C=2C=C3C(=CC2)OCO3
Synonyms:
  • 1-(1,3-Benzodioxol-5-yl)cyclopropanemethanol
  • (1-(Benzo[d][1,3]dioxol-5-yl)cyclopropyl)methanol
  • [1-(2H-1,3-Benzodioxol-5-yl)cyclopropyl]methanol
  • Cyclopropanemethanol, 1-(1,3-benzodioxol-5-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.