
CAS 98480-34-3
:1-(2,4-Dichlorophenyl)cyclopropanemethanol
Description:
1-(2,4-Dichlorophenyl)cyclopropanemethanol, with the CAS number 98480-34-3, is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a dichlorophenyl group. This compound typically exhibits properties associated with both alcohols and aromatic compounds, including potential solubility in organic solvents and moderate polarity due to the hydroxyl (-OH) group. The presence of the dichlorophenyl moiety may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the cyclopropane ring contributes to the compound's strain and reactivity, which can influence its chemical behavior in various reactions. The compound's stability, reactivity, and potential applications can vary based on its environment and the presence of other functional groups. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine atoms, which can pose environmental and health risks. Overall, 1-(2,4-Dichlorophenyl)cyclopropanemethanol is a compound of interest in both synthetic chemistry and medicinal applications.
Formula:C10H10Cl2O
InChI:InChI=1S/C10H10Cl2O/c11-7-1-2-8(9(12)5-7)10(6-13)3-4-10/h1-2,5,13H,3-4,6H2
InChI key:InChIKey=UEYAIYOKOYJMEE-UHFFFAOYSA-N
SMILES:C(O)C1(CC1)C2=C(Cl)C=C(Cl)C=C2
Synonyms:- 1-(2,4-Dichlorophenyl)cyclopropanemethanol
- [1-(2,4-Dichlorophenyl)cyclopropyl]methanol
- 1-(2,4-Dichlorophenyl)-1-cyclopropanemethanol
- Cyclopropanemethanol, 1-(2,4-dichlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.