CAS 98480-36-5

Cyclopropanemethanol, 1-(2-methoxyphenyl)-

Description:

Cyclopropanemethanol, 1-(2-methoxyphenyl)-, with the CAS number 98480-36-5, is an organic compound characterized by its unique cyclopropane structure fused with a methanol group and a 2-methoxyphenyl substituent. This compound typically exhibits a colorless to pale yellow liquid form and is known for its aromatic properties due to the presence of the methoxyphenyl group. The cyclopropane ring contributes to its strain and reactivity, making it an interesting candidate for various chemical reactions, including nucleophilic substitutions and ring-opening reactions. The methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Additionally, this compound may have applications in organic synthesis and medicinal chemistry, although specific biological activities and toxicity profiles would require further investigation. Overall, its structural features suggest potential utility in the development of novel pharmaceuticals or agrochemicals.

Formula: C₁₁H₁₄O₂

InChI: InChI=1S/C11H14O2/c1-13-10-5-3-2-4-9(10)11(8-12)6-7-11/h2-5,12H,6-8H2,1H3

InChI key: InChIKey=BQPMYLBIMQPYJP-UHFFFAOYSA-N

SMILES: C(O)C1(CC1)C2=C(OC)C=CC=C2

Synonyms:

• 1-(2-Methoxyphenyl)cyclopropanemethanol
• Cyclopropanemethanol, 1-(2-methoxyphenyl)-
• [1-(2-Methoxyphenyl)cyclopropyl]methanol