CymitQuimica logo

CAS 98486-57-8

:

N,N,1-Trimethylcyclopentanamine

Description:
N,N,1-Trimethylcyclopentanamine is an organic compound characterized by its cyclic structure and amine functional group. It features a cyclopentane ring with three methyl groups attached to the nitrogen atom, contributing to its unique properties. This compound is typically a colorless to pale yellow liquid with a distinct amine odor. It is soluble in organic solvents and exhibits moderate polarity due to the presence of the amine group. N,N,1-Trimethylcyclopentanamine is known for its potential applications in the synthesis of various chemical intermediates and as a building block in organic chemistry. Its reactivity is influenced by the amine functionality, allowing it to participate in nucleophilic substitution reactions and other transformations. Additionally, safety considerations are important when handling this compound, as it may pose health risks if inhaled or ingested. Proper storage and handling protocols should be followed to ensure safety in laboratory environments.
Formula:C8H17N
InChI:InChI=1S/C8H17N/c1-8(9(2)3)6-4-5-7-8/h4-7H2,1-3H3
InChI key:InChIKey=MJTAPCDXGFCHRE-UHFFFAOYSA-N
SMILES:N(C)(C)C1(C)CCCC1
Synonyms:
  • Cyclopentylamine, N,N,1-trimethyl-
  • Cyclopentanamine, N,N,1-trimethyl-
  • N,N,1-Trimethylcyclopentanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.