CAS 98487-57-1
:N'-hydroxy-3-(piperidin-1-yl)propanimidamide
Description:
N'-hydroxy-3-(piperidin-1-yl)propanimidamide is a chemical compound characterized by its unique structural features, which include a hydroxylamine functional group and a piperidine ring. This compound typically exhibits properties associated with amides and hydroxylamines, such as potential reactivity in nucleophilic substitution reactions and the ability to form hydrogen bonds due to the presence of the hydroxyl group. The piperidine moiety contributes to its basicity and may influence its solubility in various solvents. Additionally, compounds of this nature are often studied for their biological activity, particularly in medicinal chemistry, where they may serve as intermediates or active pharmaceutical ingredients. The presence of both the piperidine and the imidamide functionalities suggests potential applications in drug development, particularly in targeting specific biological pathways. As with many organic compounds, the stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N'-hydroxy-3-(piperidin-1-yl)propanimidamide represents a versatile structure with potential implications in various chemical and biological contexts.
Formula:C8H17N3O
InChI:InChI=1/C8H17N3O/c9-8(10-12)4-7-11-5-2-1-3-6-11/h12H,1-7H2,(H2,9,10)
SMILES:C1CCN(CC1)CCC(=N)NO
Synonyms:- (1E)-N'-Hydroxy-3-(piperidin-1-yl)propanimidamide
- 1-Piperidinepropanimidamide, N'-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.