CAS 98490-62-1

2-(4-Chlorophenoxy)ethanimidamide

Description:

2-(4-Chlorophenoxy)ethanimidamide, with the CAS number 98490-62-1, is a chemical compound characterized by its unique structure, which includes a chlorophenoxy group attached to an ethanimidamide moiety. This compound typically exhibits properties associated with both aromatic and amide functionalities, which can influence its solubility, reactivity, and biological activity. The presence of the 4-chlorophenyl group may impart specific electronic and steric effects, potentially enhancing its interaction with biological targets. In terms of physical properties, it may be a solid or liquid at room temperature, depending on its molecular weight and intermolecular forces. The compound is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential applications in drug development or as a herbicide. Safety and handling considerations are essential, as with many chemical substances, to mitigate any risks associated with exposure. Overall, 2-(4-Chlorophenoxy)ethanimidamide represents a compound with diverse potential applications, warranting further investigation into its properties and uses.

Formula: C₈H₉ClN₂O

InChI: InChI=1S/C8H9ClN2O/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H3,10,11)

InChI key: InChIKey=LSGPRLNRMANBIG-UHFFFAOYSA-N

SMILES: O(CC(=N)N)C1=CC=C(Cl)C=C1

Synonyms:

• Acetamidine, 2-(p-chlorophenoxy)-
• 2-(4-Chlorophenoxy)acetamidine
• Ethanimidamide, 2-(4-chlorophenoxy)-
• 2-(4-Chlorophenoxy)ethanimidamide