CAS 98507-51-8

Dithieno[3,2-b:2′,3′-d]thiophene, homopolymer

Description:

Dithieno[3,2-b:2′,3′-d]thiophene, homopolymer, is a conjugated polymer known for its unique electronic and optical properties, making it valuable in organic electronics and materials science. This polymer is characterized by its alternating thiophene units, which contribute to its stability and conductivity. The structure allows for effective π-π stacking, enhancing charge transport properties. It typically exhibits good solubility in organic solvents, facilitating processing techniques such as spin-coating and inkjet printing. The polymer's bandgap can be tuned through various chemical modifications, enabling applications in organic photovoltaics, field-effect transistors, and sensors. Additionally, it demonstrates thermal stability, which is crucial for practical applications. Its electrochemical properties allow for redox activity, making it suitable for use in energy storage devices. Overall, the unique structural features and properties of Dithieno[3,2-b:2′,3′-d]thiophene, homopolymer, position it as a promising material in the development of advanced electronic devices.

Formula: (C₈H₄S₃)x

InChI: InChI=1S/C8H4S3/c1-3-9-7-5(1)11-6-2-4-10-8(6)7/h1-4H

InChI key: InChIKey=VGWBXRXNERKBSJ-UHFFFAOYSA-N

SMILES: C=12C3=C(SC1C=CS2)C=CS3

Synonyms:

• Poly(dithieno[3,2-b:2′,3′-d]thiophene)
• Dithieno[3,2-b:2′,3′-d]thiophene, homopolymer

Dithieno[3,2-b:2′,3′-d]thiophene, homopolymer

CAS: 98507-51-8

Formula: C₈H₄S₃

Molecular weight: 196.3124

Ref: IN-DA01X3JQ