CAS 98537-53-2

Adenine sulfate

Description:

Adenine sulfate, with the CAS number 98537-53-2, is a chemical compound derived from adenine, a purine nucleobase that plays a crucial role in cellular metabolism and energy transfer. This compound is characterized by the presence of a sulfate group attached to the adenine structure, which can influence its solubility and reactivity. Adenine itself is a key component of nucleotides, such as ATP (adenosine triphosphate), and is involved in various biochemical processes, including DNA and RNA synthesis. The sulfate modification can enhance its biological activity and may affect its interaction with enzymes and receptors in biological systems. Adenine sulfate is typically soluble in water, making it suitable for various applications in biochemistry and molecular biology. Its role in cellular signaling and metabolism highlights its importance in both physiological and pathological contexts. As with many chemical substances, handling should be done with care, following appropriate safety guidelines to mitigate any potential hazards.

Formula: C₅H₅N₅H₂O₄S

InChI: InChI=1S/C5H5N5.H2O4S/c6-4-3-5(9-1-7-3)10-2-8-4;1-5(2,3)4/h1-2H,(H3,6,7,8,9,10);(H2,1,2,3,4)

InChI key: InChIKey=JCVRUTWJRIKTOS-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)O.NC1=C2C(=NC=N1)N=CN2

Synonyms:

• Adenine, sulfate (2:1)
• 1H-Purin-6-amine, sulfate (2:1)
• Adenine hemisulfate
• Adenine sulfate
• 9H-Purin-6-amine, sulfate (2:1)