CAS 98547-97-8

4-Pyridinecarboxylic acid, 2,6-diamino-, methyl ester

Description:

4-Pyridinecarboxylic acid, 2,6-diamino-, methyl ester, also known as methyl 2,6-diaminopyridine-4-carboxylate, is an organic compound characterized by its pyridine ring structure substituted with both carboxylic acid and amino groups. This compound typically appears as a solid or crystalline substance and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylate and amino functional groups. The presence of these functional groups imparts basic properties to the compound, allowing it to participate in various chemical reactions, including acylation and alkylation. It is often used in pharmaceutical research and synthesis due to its potential biological activity, particularly in the development of drugs targeting various diseases. Additionally, its derivatives may exhibit antimicrobial or anti-inflammatory properties. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if ingested or inhaled.

Formula: C₇H₉N₃O₂

InChI: InChI=1S/C7H9N3O2/c1-12-7(11)4-2-5(8)10-6(9)3-4/h2-3H,1H3,(H4,8,9,10)

InChI key: InChIKey=ZTXQOPYHQAOGKZ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C(N)N=C(N)C1

Synonyms:

• 4-Pyridinecarboxylic acid, 2,6-diamino-, methyl ester
• 2,6-Diaminoisonicotinic acid methyl ester
• Methyl 2,6-diaminopyridine-4-carboxylate
• Isonicotinic acid, 2,6-diamino-, methyl ester