CAS 98555-13-6
:2-methyl-7-oxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylic acid
Description:
2-Methyl-7-oxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylic acid is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of a methyl group at the 2-position and a keto group at the 7-position enhances its chemical reactivity and potential biological activity. Typically, compounds of this class may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The molecular structure allows for potential interactions with biological targets, which could lead to applications in drug development. Additionally, the compound's solubility and stability can be influenced by the functional groups present, affecting its behavior in different solvents and conditions. Overall, 2-methyl-7-oxo-4H-pyrazolo[1,5-a]pyrimidine-6-carboxylic acid represents a unique scaffold for further exploration in chemical and pharmaceutical research.
Formula:C8H7N3O3
InChI:InChI=1/C8H7N3O3/c1-4-2-6-9-3-5(8(13)14)7(12)11(6)10-4/h2-3,9H,1H3,(H,13,14)
SMILES:Cc1cc2[nH]cc(c(=O)n2n1)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Methyl-7-oxo-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxylic acid
CAS:Formula:C8H7N3O3Molecular weight:193.1595
