CAS 98555-71-6

5-(2,5-Dichlorophenyl)-1H-tetrazole

Description:

5-(2,5-Dichlorophenyl)-1H-tetrazole is a chemical compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. The presence of the 2,5-dichlorophenyl group contributes to its unique properties, including potential biological activity and applications in pharmaceuticals or agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry. Additionally, the dichlorophenyl substituent can influence the compound's electronic properties and reactivity, potentially enhancing its efficacy in biological systems. Safety data should be consulted, as halogenated compounds can exhibit toxicity or environmental persistence. Overall, 5-(2,5-Dichlorophenyl)-1H-tetrazole is a notable compound in the realm of chemical research, with implications in various fields.

Formula: C₇H₄Cl₂N₄

InChI: InChI=1/C7H4Cl2N4/c8-4-1-2-6(9)5(3-4)7-10-12-13-11-7/h1-3H,(H,10,11,12,13)

SMILES: c1cc(c(cc1Cl)c1n[nH]nn1)Cl

Synonyms:

• 5-(2,5-dichlorophenyl)-2H-tetrazole

1-(2,5-Dichlorophenyl)tetrazole

CAS: 98555-71-6

Formula: C₇H₄Cl₂N₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 215.0395

Ref: IN-DA003M3C

5-(2,5-Dichlorophenyl)-1H-tetrazole

CAS: 98555-71-6

Please enquire for more information about 5-(2,5-Dichlorophenyl)-1H-tetrazole including the price, delivery time and more detailed product information at the technical inquiry form on this page

Purity: Min. 95%

Ref: 3D-FD169049