CymitQuimica logo

CAS 98569-12-1

:

2-[(tert-butoxycarbonyl)amino]-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid

Description:
2-[(tert-butoxycarbonyl)amino]-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid, with the CAS number 98569-12-1, is an organic compound characterized by its complex structure, which includes a tetrahydronaphthalene core, an amino group, and a carboxylic acid functional group. The tert-butoxycarbonyl (Boc) group serves as a protective group for the amino functionality, making it useful in peptide synthesis and other organic reactions. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic naphthalene structure. Its chemical properties are influenced by the presence of both the carboxylic acid and the amino group, allowing for potential interactions such as hydrogen bonding. The compound may be utilized in various applications, including medicinal chemistry and as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C16H21NO4
InChI:InChI=1/C16H21NO4/c1-15(2,3)21-14(20)17-16(13(18)19)9-8-11-6-4-5-7-12(11)10-16/h4-7H,8-10H2,1-3H3,(H,17,20)(H,18,19)
InChI key:DSDQZWPRZHNCIX-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=NC1(CCc2ccccc2C1)C(=O)O)O
Synonyms:
  • 2-Naphthalenecarboxylic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-1,2,3,4-tetrahydro-
  • (2S)-2-[(tert-butoxycarbonyl)amino]-1,2,3,4-tetrahydronaphthalene-2-carboxylate
  • (2R)-2-[(tert-butoxycarbonyl)amino]-1,2,3,4-tetrahydronaphthalene-2-carboxylate
  • 2-(Tert-Butoxycarbonylamino)-1,2,3,4-Tetrahydronaphthalene-2-Carboxylic Acid
Found 4 products.