CAS 98569-64-3
:Ergosta-5,24-dien-26-oic acid, 1,3,22,27-tetrahydroxy-, δ-lactone, (1α,3β,22R)-
Description:
Ergosta-5,24-dien-26-oic acid, 1,3,22,27-tetrahydroxy-, δ-lactone, (1α,3β,22R)-, is a complex organic compound belonging to the class of sterols and is characterized by its unique structural features, including multiple hydroxyl groups and a lactone functional group. This compound is derived from ergosterol, a sterol found in fungi, and exhibits a specific stereochemistry denoted by its (1α,3β,22R)- configuration. The presence of multiple hydroxyl groups contributes to its potential biological activities, including antioxidant properties and interactions with cellular membranes. The δ-lactone structure suggests that it may participate in various chemical reactions, such as hydrolysis or esterification, under appropriate conditions. This compound is of interest in the fields of biochemistry and pharmacology, particularly for its potential applications in medicinal chemistry and as a natural product with therapeutic properties. Its CAS number, 98569-64-3, allows for easy identification and reference in scientific literature and databases.
Formula:C28H42O5
InChI:InChI=1S/C28H42O5/c1-15-11-24(33-26(32)20(15)14-29)16(2)21-7-8-22-19-6-5-17-12-18(30)13-25(31)28(17,4)23(19)9-10-27(21,22)3/h5,16,18-19,21-25,29-31H,6-14H2,1-4H3/t16-,18+,19-,21+,22-,23-,24+,25-,27+,28-/m0/s1
InChI key:InChIKey=FYYIHVSEGVWNCF-RMDUJBCISA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@]([C@H](C)[C@]5(CC(C)=C(CO)C(=O)O5)[H])(CC4)[H])[H])(CC=C1C[C@@H](O)C[C@@H]2O)[H])[H]
Synonyms:- Ergosta-5,24-dien-26-oic acid, 1,3,22,27-tetrahydroxy-, δ-lactone, (1α,3β,22R)-
- Pubesenolide
- Sominone
- (22R)-1α,3β,22,27-Tetrahydroxyergosta-5,24-diene-26-oic acid 26,22-lactone
- [22R,(+)]-1α,3β,22,27-Tetrahydroxyergosta-5,24-dien-26-oic acid 26,22-lactone
- [22R,(+)]-1α,3β,22,27-Tetrahydroxyergosta-5,24-diene-26-oic acid 26,22-lactone
- (+)-1α,3β,27-Trihydroxy-5,24-withadienolide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Pubesenolide
CAS:Controlled ProductApplications Pubesenolide is a steroidal sapogenin that was found to improve memory impairments and increase axonal density in Alzheimer’s disease in model mice.
References Joyashiki, E., et al.: Int. J. Neurosci., 121, 181 (2011); Kuroyanagi, M., et al.: Chem. Pharma. Bull., 47, 1646 (1999);Formula:C28H42O5Color and Shape:NeatMolecular weight:458.63Pubesenolide
CAS:Pubesenolide is a naturally derived compound, which is a unique type of sesquiterpene lactone sourced from specific plant species. Its mechanism of action involves modulation of biochemical pathways involved in inflammation and cellular proliferation, making it a subject of interest for pharmacological research. Pubesenolide exhibits potential in interacting with cellular components to alter gene expression profiles, specifically targeting inflammatory and proliferative processes at the molecular level.Formula:C28H42O5Purity:Min. 95%Molecular weight:458.6 g/mol


