CAS 98581-86-3

4-(4-Hydroxyphenyl)-1,2,4-triazole

Description:

4-(4-Hydroxyphenyl)-1,2,4-triazole, with the CAS number 98581-86-3, is an organic compound characterized by its triazole ring and a hydroxyphenyl substituent. This compound features a five-membered heterocyclic structure containing three nitrogen atoms, which contributes to its potential biological activity. The presence of the hydroxy group (-OH) on the phenyl ring enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. 4-(4-Hydroxyphenyl)-1,2,4-triazole is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential as a fungicide and its role in the synthesis of other chemical entities. Its properties may include moderate stability under standard conditions, and it may exhibit specific absorption characteristics in UV-Vis spectroscopy. Additionally, the compound's structure allows for various functionalization possibilities, making it a versatile building block in organic synthesis. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₆H₁₂N₂O₂

InChI: InChI=1/C6H12N2O2/c7-2-4-8-3-1-5-10-6(8)9/h1-5,7H2

SMILES: C1CN(CCN)C(=O)OC1

Synonyms:

• 4-(4H-1,2,4-Triazol-4-yl)phenol
• 4-(4-(2-bromoethoxy)phenyl)-4H-1,2,4-triazole
• 4-(1,2,4-Triazol-4-Yl)Phenol

4-(4H-1,2,4-Triazol-4-yl)phenol

CAS: 98581-86-3

Formula: C₈H₇N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 161.1607

Ref: IN-DA006R6Z

4-(4H-1,2,4-Triazol-4-yl)phenol

CAS: 98581-86-3

4-(4H-1,2,4-Triazol-4-yl)phenol

Purity: 97%

Molecular weight: 161.16g/mol

Ref: 54-OR75373

4-(4H-1,2,4-Triazol-4-yl)phenol

CAS: 98581-86-3

Formula: C₈H₇N₃O

Purity: 97%

Color and Shape: Solid, White powder

Molecular weight: 161.164

Ref: 10-F224880