CAS 98583-30-3
:(E)-bis(4-bromo-2,3,5,6-tetrafluorophenyl)diazene
Description:
(E)-bis(4-bromo-2,3,5,6-tetrafluorophenyl)diazene, identified by its CAS number 98583-30-3, is a synthetic organic compound characterized by its unique structure featuring a diazene functional group (-N=N-) and two 4-bromo-2,3,5,6-tetrafluorophenyl substituents. This compound exhibits significant electron-withdrawing properties due to the presence of multiple fluorine atoms and bromine, which can influence its reactivity and stability. The tetrafluorophenyl groups contribute to its potential applications in materials science, particularly in the development of dyes or pigments, as well as in organic electronics. The compound's geometric configuration as an E-isomer indicates that the substituents on the diazene are on opposite sides, which can affect its physical properties, such as solubility and melting point. Additionally, the presence of halogen atoms may enhance its photostability and alter its interaction with light, making it of interest in photochemical studies. Overall, this compound represents a fascinating example of halogenated organic chemistry with potential applications in various fields.
Formula:C12Br2F8N2
InChI:InChI=1/C12Br2F8N2/c13-1-3(15)7(19)11(8(20)4(1)16)23-24-12-9(21)5(17)2(14)6(18)10(12)22/b24-23+
Synonyms:- Azobenzene, 2,2',3,3',5,5',6,6'-octafluoro-4,4'-dibromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.