CAS 98589-40-3
:6-amino-4-methyl-2H-chromen-2-one
Description:
6-Amino-4-methyl-2H-chromen-2-one, also known as a derivative of coumarin, is a chemical compound characterized by its chromenone structure, which features a benzopyrone core. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). The presence of an amino group at the 6-position and a methyl group at the 4-position contributes to its unique chemical reactivity and potential biological activity. It may exhibit properties such as fluorescence and has been studied for its potential applications in pharmaceuticals, particularly as an anti-inflammatory or antimicrobial agent. The compound's structure allows for various chemical modifications, which can enhance its biological efficacy or alter its solubility characteristics. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, 6-amino-4-methyl-2H-chromen-2-one represents a versatile scaffold in medicinal chemistry.
Formula:C10H9NO2
InChI:InChI=1/C10H9NO2/c1-6-4-10(12)13-9-3-2-7(11)5-8(6)9/h2-5H,11H2,1H3
SMILES:Cc1cc(=O)oc2ccc(cc12)N
Synonyms:- 6-Amino-4-methyl-2H-chromen-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
6-Amino-4-methyl-2H-chromen-2-one
CAS:6-Amino-4-methyl-2H-chromen-2-one is a compound that exhibits fatty acid-like characteristics, making it suitable for applications requiring lubricity. It can be used as a benzoate in the formulation of metal oxide particles and is commonly utilized in the field of Research Chemicals. Additionally, this compound has been found to interact with oligosaccharides, influencing progesterone concentration and modulating electrode behavior. Furthermore, 6-Amino-4-methyl-2H-chromen-2-one has potential applications in pharmaceutical preparations due to its ability to enhance water vapor emission and promote glycan and collagen synthesis. With its diverse range of properties, this compound offers numerous opportunities for innovation across various industries.Formula:C9H7NO2Purity:Min. 95%Molecular weight:161.16 g/mol
