CAS 98589-71-0
:4-(3-Pyridinyl)pyrimidine
Description:
4-(3-Pyridinyl)pyrimidine is an organic compound characterized by its heterocyclic structure, which includes both pyridine and pyrimidine rings. The compound features a pyridine ring substituted at the 4-position with a pyrimidine moiety, contributing to its potential biological activity. It is typically a crystalline solid at room temperature and is soluble in polar organic solvents. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly as a scaffold for designing inhibitors targeting various biological pathways. Its molecular structure allows for interactions with biological targets, making it a candidate for further research in pharmacology. Additionally, the presence of nitrogen atoms in both rings can influence its reactivity and interaction with other chemical species. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H7N3
InChI:InChI=1S/C9H7N3/c1-2-8(6-10-4-1)9-3-5-11-7-12-9/h1-7H
InChI key:InChIKey=PSXJPOTVCKWHGZ-UHFFFAOYSA-N
SMILES:C=1(C=CC=NC1)C=2C=CN=CN2
Synonyms:- 4-(3-Pyridinyl)pyrimidine
- Pyrimidine, 4-(3-pyridinyl)-
- Pyrimidine, 4-(3-pyridyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
