
CAS 98593-60-3
:β-Amino-5-methyl-2-thiophenepropanoic acid
Description:
β-Amino-5-methyl-2-thiophenepropanoic acid, with the CAS number 98593-60-3, is an organic compound characterized by its unique structure that includes a thiophene ring, an amino group, and a propanoic acid moiety. This compound typically exhibits properties associated with amino acids, such as the ability to form zwitterions in solution due to the presence of both amino and carboxylic acid functional groups. The thiophene ring contributes to its aromatic character and may influence its reactivity and solubility. β-Amino-5-methyl-2-thiophenepropanoic acid is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other compounds. Its specific melting point, boiling point, and solubility characteristics would depend on the conditions under which it is studied. Overall, this compound represents a fascinating intersection of amino acid chemistry and heterocyclic chemistry, making it a subject of interest for further research and application.
Formula:C8H11NO2S
InChI:InChI=1S/C8H11NO2S/c1-5-2-3-7(12-5)6(9)4-8(10)11/h2-3,6H,4,9H2,1H3,(H,10,11)
InChI key:InChIKey=RQUGFBQKYPDSSM-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(N)C=1SC(C)=CC1
Synonyms:- 3-Amino-3-(5-methylthiophen-2-yl)propanoic acid
- 3-Amino-3-(5-methyl-[2]thienyl)-propionic acid
- β-Amino-5-methyl-2-thiophenepropanoic acid
- 2-Thiophenepropionic acid, β-amino-5-methyl-
- 2-Thiophenepropanoic acid, β-amino-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.