CAS 98593-81-8

Carbamic acid, 2-thenyl-, 2-hydroxyethyl ester

Description:

Carbamic acid, 2-thenyl-, 2-hydroxyethyl ester, with the CAS number 98593-81-8, is an organic compound characterized by its ester functional group derived from carbamic acid. This compound features a 2-thenyl group, which is a thiophene derivative, contributing to its aromatic properties and potential reactivity. The presence of a hydroxyethyl group enhances its solubility in polar solvents and may influence its biological activity. Typically, carbamic acid esters are known for their applications in agriculture as pesticides or herbicides, as well as in pharmaceuticals due to their ability to interact with biological systems. The compound may exhibit moderate to low toxicity, depending on its specific structure and substituents. Its stability can be influenced by environmental factors such as pH and temperature, which are important considerations for its handling and storage. Overall, the unique combination of functional groups in this compound suggests potential utility in various chemical applications, although specific data on its reactivity and biological effects would require further investigation.

Formula: C₈H₁₁NO₃S

InChI: InChI=1S/C8H11NO3S/c10-3-4-12-8(11)9-6-7-2-1-5-13-7/h1-2,5,10H,3-4,6H2,(H,9,11)

InChI key: InChIKey=QWLGXTSJOZOKBP-UHFFFAOYSA-N

SMILES: C(NC(OCCO)=O)C1=CC=CS1

Synonyms:

• 2-Hydroxyethyl N-(thiophen-2-ylmethyl)carbamate
• Carbamic acid, 2-thenyl-, 2-hydroxyethyl ester