CAS 98594-47-9

propyl 6-aminopyridazine-3-carboxylate

Description:

Propyl 6-aminopyridazine-3-carboxylate is a chemical compound characterized by its pyridazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features a propyl group attached to the nitrogen atom of the amino group, as well as a carboxylate functional group at the 3-position of the pyridazine ring. The presence of the amino group contributes to its potential as a building block in pharmaceutical synthesis, as it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The carboxylate group enhances its solubility in polar solvents and may influence its reactivity and biological activity. Additionally, the compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Its unique combination of functional groups allows for diverse interactions, making it a subject of interest in research related to organic synthesis and drug discovery.

Formula: C₈H₁₁N₃O₂

InChI: InChI=1/C8H11N3O2/c1-2-5-13-8(12)6-3-4-7(9)11-10-6/h3-4H,2,5H2,1H3,(H2,9,11)

SMILES: CCCOC(=O)c1ccc(=N)[nH]n1

Synonyms:

• 3-Pyridazinecarboxylic Acid, 6-Amino-, Propyl Ester
• 6-Aminopyridazine-3-carboxylate de propyle
• Propyl 6-amino-3-pyridazinecarboxylate
• Propyl-6-aminopyridazin-3-carboxylat