CAS 98600-74-9

4-{[2-(~2~H_3_)methylhydrazinyl]methyl}-N-(propan-2-yl)benzamide

Description:

4-{[2-(~2~H_3_)methylhydrazinyl]methyl}-N-(propan-2-yl)benzamide, with the CAS number 98600-74-9, is a chemical compound that features a hydrazine moiety, which is known for its reactivity and potential biological activity. This compound contains a benzamide structure, indicating the presence of an amide functional group attached to a benzene ring, which contributes to its stability and solubility characteristics. The presence of a propan-2-yl group suggests that it may exhibit steric hindrance, potentially influencing its interaction with biological targets. The methylhydrazinyl group indicates that the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the isotopic labeling with deuterium (indicated by ~2~H_3) may be utilized in studies involving metabolic pathways or pharmacokinetics. Overall, this compound's unique structural features may confer specific properties that are of interest in both research and industrial applications, particularly in the fields of drug development and chemical synthesis.

Formula: C₁₂H₁₆D₃N₃O

InChI: InChI=1/C12H19N3O/c1-9(2)15-12(16)11-6-4-10(5-7-11)8-14-13-3/h4-7,9,13-14H,8H2,1-3H3,(H,15,16)/i3D3

SMILES: CC(C)NC(=O)c1ccc(cc1)CNNC([2H])([2H])[2H]

Procarbazine-d3

CAS: 98600-74-9

Formula: C₁₂H₁₆D₃N₃O

Molecular weight: 224.32

Ref: 4Z-P-309002