CAS 98601-03-7

(6Z)-6-imino-1,9-dimethyl-1,6,7,9-tetrahydro-8H-purin-8-one

Description:

(6Z)-6-imino-1,9-dimethyl-1,6,7,9-tetrahydro-8H-purin-8-one, with the CAS number 98601-03-7, is a purine derivative characterized by its unique structural features. This compound contains a fused bicyclic structure typical of purines, which includes a pyrimidine and an imidazole ring. The presence of a 6-imino group contributes to its reactivity and potential biological activity. The dimethyl substitutions at the 1 and 9 positions enhance its lipophilicity, potentially influencing its interaction with biological membranes and receptors. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the stereochemistry indicated by the "(6Z)" configuration suggests specific spatial arrangements that could affect its biological interactions. Overall, this compound represents a class of molecules that may have significant implications in biochemistry and pharmacology.

Formula: C₇H₉N₅O

InChI: InChI=1/C7H9N5O/c1-11-3-9-6-4(5(11)8)10-7(13)12(6)2/h3,8H,1-2H3,(H,10,13)/b8-5-

6-Imino-1,9-dimethyl-7,9-dihydro-1H-purin-8(6H)-one

Controlled Product

CAS: 98601-03-7

Hymeniacidon is a genus of marine sponges that grows in the Mediterranean Sea. This sponge contains 6-imino-1,9-dimethyl-7,9-dihydro-1H-purin-8(6H)-one (6IDDMUP), a compound that may have anticancer properties. 6IDDMUP is structurally related to other natural products, such as brominated sanguinine and hydrolyzed hymeniacidonin, which have been shown to inhibit the growth of various cancer cells in vitro.

Formula: C₇H₉N₅O

Purity: Min. 95%

Molecular weight: 179.18 g/mol

Ref: 3D-YDA60103