CymitQuimica logo

CAS 98602-43-8

:

4-Cyclobutyl-2-butanone

Description:
4-Cyclobutyl-2-butanone is an organic compound characterized by its ketone functional group and a cyclobutyl substituent. It features a four-carbon butanone backbone with a cyclobutyl ring attached to the fourth carbon. This structure contributes to its unique chemical properties, including its reactivity and potential applications in organic synthesis. The compound is typically a colorless to pale yellow liquid at room temperature, exhibiting a distinctive odor. Its molecular structure allows for various interactions, making it useful in the development of pharmaceuticals and agrochemicals. The presence of the cyclobutyl group can influence the compound's steric and electronic properties, affecting its behavior in chemical reactions. Additionally, 4-Cyclobutyl-2-butanone may participate in various reactions typical of ketones, such as nucleophilic addition and oxidation. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential health hazards. Overall, this compound represents an interesting subject for study in organic chemistry and material science.
Formula:C8H14O
InChI:InChI=1S/C8H14O/c1-7(9)5-6-8-3-2-4-8/h8H,2-6H2,1H3
InChI key:InChIKey=CJQLXYNXAPVUHE-UHFFFAOYSA-N
SMILES:C(CC(C)=O)C1CCC1
Synonyms:
  • 2-Butanone, 4-cyclobutyl-
  • 4-Cyclobutyl-2-butanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.