CAS 98604-39-8
:3,4-Dinitrobenzamide
Description:
3,4-Dinitrobenzamide is an organic compound characterized by the presence of two nitro groups (-NO2) and an amide functional group (-CONH2) attached to a benzene ring. The nitro groups are positioned at the 3 and 4 positions relative to the amide group, which influences the compound's reactivity and properties. This substance typically appears as a yellow crystalline solid and is known for its relatively high stability under standard conditions. It is soluble in organic solvents but has limited solubility in water. The presence of the nitro groups contributes to its potential as an explosive material, as well as its use in various chemical syntheses and applications in research. Additionally, 3,4-Dinitrobenzamide can undergo various chemical reactions, including reduction and substitution, making it a valuable intermediate in organic synthesis. Safety precautions are essential when handling this compound due to its potential toxicity and explosive nature.
Formula:C7H5N3O5
InChI:InChI=1S/C7H5N3O5/c8-7(11)4-1-2-5(9(12)13)6(3-4)10(14)15/h1-3H,(H2,8,11)
InChI key:InChIKey=CZJXPRIRONCXCN-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N(=O)=O)C=CC(C(N)=O)=C1
Synonyms:- 3,4-Dinitrobenzamide
- Benzamide, 3,4-dinitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.