CymitQuimica logo

CAS 98604-89-8

:

1,1′-[Dithiobis[(1-oxo-4,1-butanediyl)oxy]]bis[2,5-dioxo-3-pyrrolidinesulfonic acid]

Description:
1,1′-[Dithiobis[(1-oxo-4,1-butanediyl)oxy]]bis[2,5-dioxo-3-pyrrolidinesulfonic acid], with CAS number 98604-89-8, is a synthetic chemical compound characterized by its complex structure that includes dithiobis and pyrrolidine sulfonic acid moieties. This compound typically exhibits properties associated with both sulfonic acids and dithiols, which may contribute to its potential applications in various fields, including biochemistry and materials science. It is likely to be soluble in polar solvents due to the presence of sulfonic acid groups, which enhance its hydrophilicity. The compound may also exhibit redox activity due to the dithiobis linkage, allowing it to participate in electron transfer reactions. Its unique structure suggests potential utility as a reagent in chemical synthesis or as a biological probe, although specific applications would depend on further research into its reactivity and interactions with biological systems. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper use and minimize risks.
Formula:C16H20N2O14S4
InChI:InChI=1S/C16H20N2O14S4/c19-11-7-9(35(25,26)27)15(23)17(11)31-13(21)3-1-5-33-34-6-2-4-14(22)32-18-12(20)8-10(16(18)24)36(28,29)30/h9-10H,1-8H2,(H,25,26,27)(H,28,29,30)
InChI key:InChIKey=RIUSVHPDQDXRGU-UHFFFAOYSA-N
SMILES:O(C(CCCSSCCCC(ON1C(=O)C(S(=O)(=O)O)CC1=O)=O)=O)N2C(=O)C(S(=O)(=O)O)CC2=O
Synonyms:
  • 3-Pyrrolidinesulfonic acid, 1,1′-[dithiobis[(1-oxo-4,1-butanediyl)oxy]]bis[2,5-dioxo-
  • 1,1′-[Dithiobis[(1-oxo-4,1-butanediyl)oxy]]bis[2,5-dioxo-3-pyrrolidinesulfonic acid]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.