CAS 98626-50-7

3-[[1-(Ethoxycarbonyl)-3-phenylpropyl]amino]-2,3,4,5-tetrahydro-2-oxo-1H-1-benzazepine-1-acetic acid

Description:

The chemical substance known as 3-[[1-(Ethoxycarbonyl)-3-phenylpropyl]amino]-2,3,4,5-tetrahydro-2-oxo-1H-1-benzazepine-1-acetic acid, with the CAS number 98626-50-7, is a complex organic compound characterized by its multi-functional structure. It features a benzazepine core, which is a bicyclic structure that includes a seven-membered ring fused to a six-membered ring, contributing to its potential biological activity. The presence of an ethoxycarbonyl group indicates that it has an ester functionality, which can influence its solubility and reactivity. Additionally, the amino group suggests potential for hydrogen bonding and interaction with biological targets. The compound's tetrahydro configuration implies it is a saturated derivative, which may enhance its stability and bioavailability. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. However, specific characteristics such as solubility, melting point, and biological activity would require empirical data for precise evaluation.

Formula: C₂₄H₂₈N₂O₅

InChI: InChI=1S/C24H28N2O5/c1-2-31-24(30)20(14-12-17-8-4-3-5-9-17)25-19-15-13-18-10-6-7-11-21(18)26(23(19)29)16-22(27)28/h3-11,19-20,25H,2,12-16H2,1H3,(H,27,28)

InChI key: InChIKey=XPCFTKFZXHTYIP-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C=2C(CCC(NC(CCC3=CC=CC=C3)C(OCC)=O)C1=O)=CC=CC2

Synonyms:

• 1H-1-Benzazepine-1-acetic acid, 3-[[1-(ethoxycarbonyl)-3-phenylpropyl]amino]-2,3,4,5-tetrahydro-2-oxo-
• 3-[[1-(Ethoxycarbonyl)-3-phenylpropyl]amino]-2,3,4,5-tetrahydro-2-oxo-1H-1-benzazepine-1-acetic acid

Benazepril Impurity B

CAS: 98626-50-7

Formula: C₂₄H₂₈N₂O₅

Molecular weight: 424.50

Ref: 4Z-B-0113

O-Ethoxy Benazeprilat

Controlled Product

CAS: 98626-50-7

Formula: C₂₄H₂₈N₂O₅

Color and Shape: Neat

Molecular weight: 424.49

Ref: TR-C496440