
CAS 98632-92-9
:1H-Pyrazole-1-propanoic acid, α-[[(phenylmethoxy)carbonyl]amino]-, (R)-
Description:
1H-Pyrazole-1-propanoic acid, α-[[(phenylmethoxy)carbonyl]amino]-, (R)-, with CAS number 98632-92-9, is a chiral organic compound characterized by its pyrazole ring structure and a propanoic acid functional group. This compound features a phenylmethoxycarbonyl group, which contributes to its potential as a pharmaceutical intermediate or active ingredient. The presence of the chiral center indicates that it exists in two enantiomeric forms, with the (R)- configuration being of particular interest in medicinal chemistry due to its specific biological activity. The compound is likely to exhibit moderate solubility in polar solvents, and its acidic nature is attributed to the carboxylic acid group. Additionally, the pyrazole moiety may impart unique reactivity and interaction properties, making it suitable for various applications in drug development and synthesis. Overall, this compound's structural features suggest potential utility in therapeutic contexts, particularly in the development of agents targeting specific biological pathways.
Formula:C14H15N3O4
InChI:InChI=1S/C14H15N3O4/c18-13(19)12(9-17-8-4-7-15-17)16-14(20)21-10-11-5-2-1-3-6-11/h1-8,12H,9-10H2,(H,16,20)(H,18,19)/t12-/m1/s1
InChI key:InChIKey=IQMIVNGNLQKTJX-GFCCVEGCSA-N
SMILES:[C@H](CN1C=CC=N1)(NC(OCC2=CC=CC=C2)=O)C(O)=O
Synonyms:- 1H-Pyrazole-1-propanoic acid, α-[[(phenylmethoxy)carbonyl]amino]-, (R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.