CAS 98633-61-5

Sarmentocymarin

Description:

Sarmentocymarin is a chemical compound classified as a steroidal alkaloid, primarily derived from the plant species *Cynanchum sarmentosum*. It is known for its potential pharmacological properties, including anti-inflammatory and anti-cancer activities. Sarmentocymarin exhibits a complex molecular structure characterized by multiple rings and functional groups typical of steroidal compounds. Its mechanism of action may involve modulation of various biological pathways, although detailed studies are still ongoing to fully elucidate its effects. The compound has garnered interest in medicinal chemistry due to its bioactive properties, which could lead to therapeutic applications. However, like many natural products, its efficacy and safety profile require thorough investigation through clinical studies. As with any chemical substance, proper handling and safety precautions are essential, particularly in laboratory settings, to mitigate any potential risks associated with its use.

Formula: C₃₀H₄₆O₈

InChI: InChI=1S/C30H46O8/c1-16-27(33)23(35-4)13-25(37-16)38-19-7-9-28(2)18(12-19)5-6-21-26(28)22(31)14-29(3)20(8-10-30(21,29)34)17-11-24(32)36-15-17/h11,16,18-23,25-27,31,33-34H,5-10,12-15H2,1-4H3/t16-,18-,19+,20-,21-,22-,23+,25+,26-,27+,28+,29-,30+/m1/s1

InChI key: InChIKey=LEORFFVSVUWAEY-VKZDBDJISA-N

SMILES: O[C@@]12[C@]3([C@@]([C@]4(C)[C@](CC3)(C[C@@H](O[C@H]5C[C@H](OC)[C@@H](O)[C@@H](C)O5)CC4)[H])([C@H](O)C[C@]1(C)[C@H](CC2)C6=CC(=O)OC6)[H])[H]

Synonyms:

• Sarmentocymarin
• Card-20(22)-enolide, 3-[(2,6-dideoxy-3-O-methyl-β-D-xylo-hexopyranosyl)oxy]-11,14-dihydroxy-, (3β,5β,11α)-
• (3β,5β,11α)-3-[(2,6-Dideoxy-3-O-methyl-β-D-xylo-hexopyranosyl)oxy]-11,14-dihydroxycard-20(22)-enolide

Sarmentocymarin

CAS: 98633-61-5

Formula: C₃₀H₄₆O₈

Color and Shape: Solid

Molecular weight: 534.6814

Ref: IN-DA01P3WI

Sarmentocymarin

CAS: 98633-61-5

Sarmentocymarin is a cardiac glucoside.

Formula: C₃₀H₄₆O₈

Purity: 98%

Color and Shape: Solid

Molecular weight: 534.69

Ref: TM-TN4949

Sarmentocymarin

CAS: 98633-61-5

Sarmentocymarin is a cardiac glycoside, which is a natural compound primarily sourced from certain species of the Cynanchum plant. These glycosides are well-known for their action on the cardiac muscle tissue, significantly influencing cardiac contractility. The mode of action of sarmentocymarin involves the inhibition of the Na⁺/K⁺-ATPase enzyme, leading to an increased intracellular concentration of calcium ions in cardiac cells. This results in a positive inotropic effect, which essentially enhances the force of heart muscle contractions.

Formula: C₃₀H₄₆O₈

Purity: Min. 95%

Molecular weight: 534.7 g/mol

Ref: 3D-YDA63361