CAS 98644-24-7
:Zedoarondiol
Description:
Zedoarondiol, with the CAS number 98644-24-7, is a chemical compound that belongs to the class of terpenoids, specifically derived from the essential oil of the Zedoary plant, which is a type of ginger. This compound is characterized by its unique structural features, including multiple hydroxyl groups, which contribute to its potential biological activities. Zedoarondiol is known for its aromatic properties and may exhibit various pharmacological effects, including anti-inflammatory and antimicrobial activities. Its solubility characteristics typically allow it to dissolve in organic solvents, while its functional groups may influence its reactivity and interactions with other molecules. Additionally, zedoarondiol's presence in natural products highlights its significance in traditional medicine and potential applications in the development of therapeutic agents. As with many natural compounds, further research is necessary to fully elucidate its mechanisms of action and potential uses in various fields, including pharmaceuticals and cosmetics.
Formula:C15H24O3
InChI:InChI=1S/C15H24O3/c1-9(2)10-7-12-11(5-6-14(12,3)17)15(4,18)8-13(10)16/h11-12,17-18H,5-8H2,1-4H3/t11-,12+,14-,15+/m1/s1
InChI key:InChIKey=TXIKNNOOLCGADE-OSRDXIQISA-N
SMILES:C[C@]1(O)[C@@]2([C@]([C@@](C)(O)CC(=O)C(=C(C)C)C2)(CC1)[H])[H]
Synonyms:- (1R,3aR,4S,8aS)-Octahydro-1,4-dihydroxy-1,4-dimethyl-7-(1-methylethylidene)-6(1H)-azulenone
- 6(1H)-Azulenone,octahydro-1,4-dihydroxy-1,4-dimethyl-7-(1-methylethylidene)-, [1R-(1a,3aa,4b,8ab)]-
- Zedoarondiol
- 6(1H)-Azulenone, octahydro-1,4-dihydroxy-1,4-dimethyl-7-(1-methylethylidene)-, (1R,3aR,4S,8aS)-
- isozedoarondiol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
6(1H)-Azulenone, octahydro-1,4-dihydroxy-1,4-dimethyl-7-(1-methylethylidene)-, (1R,3aR,4S,8aS)-
CAS:Formula:C15H24O3Purity:98%Color and Shape:SolidMolecular weight:252.3493Zedoarondiol
CAS:Zedoarondiol is a natural compound, which is derived from the rhizome of the Curcuma zedoaria plant. This plant, belonging to the Zingiberaceae family, is native to South and Southeast Asia, where it has been traditionally used in various medicinal practices. The compound acts primarily as an anti-inflammatory and antioxidative agent, working through the modulation of specific molecular pathways, including the suppression of pro-inflammatory cytokines and the scavenging of free radicals.
Formula:C15H24O3Purity:Min. 95%Molecular weight:252.35 g/molZedoarondiol
CAS:Zedoarondiol has anti-inflammatory activity, inhibits iNOS, COX-2, and pro-inflammatory cytokine expressions by suppressing the phosphorylations of IKK and MAPKs, and by subsequently inactivating the NF-kappaB pathway.Formula:C15H24O3Purity:98.00%Color and Shape:SolidMolecular weight:252.354


