CAS 98665-14-6
:Ganoderic acid E
Description:
Ganoderic acid E is a triterpenoid compound primarily derived from the Ganoderma lucidum mushroom, commonly known as reishi or lingzhi. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups typical of triterpenes. Ganoderic acid E exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. Its solubility is generally low in water but can be dissolved in organic solvents, which is common for many triterpenoids. The compound's bioactivity is attributed to its ability to modulate various signaling pathways and its interaction with cellular receptors. Additionally, Ganoderic acid E is part of a larger class of ganoderic acids, which are known for their diverse therapeutic effects. Research continues to explore its potential applications in medicine and health supplements, highlighting the importance of natural products in drug discovery and development.
Formula:C30H40O7
InChI:InChI=1S/C30H40O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h15-16,18,21H,8-14H2,1-7H3,(H,36,37)/t15-,16-,18-,21+,28+,29-,30+/m1/s1
InChI key:InChIKey=VBGDQDJVTLQGNO-JXLWEQSJSA-N
SMILES:C[C@]12C3=C([C@]4(C)[C@@](CC3=O)(C(C)(C)C(=O)CC4)[H])C(=O)C[C@]1(C)[C@@]([C@@H](CC(C[C@H](C(O)=O)C)=O)C)(CC2=O)[H]
Synonyms:- Ganoderic acid F
- Lanost-8-en-26-oic acid, 3,7,11,15,23-pentaoxo-, (25R)-
- Ganoderic acid E
- (25R)-3,7,11,15,23-Pentaoxolanost-8-en-26-oic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ganoderic acid E
CAS:Controlled ProductGanoderic acid E is a natural product that belongs to the group of fatty acids. It has been shown to have significant cytotoxic effects against cancer cells, and may be a potential treatment for cervical cancer. The structure of this compound was determined by means of spectroscopic analysis and chemical synthesis. Ganoderic acid E contains two hydroxyl groups, one carbonyl group, and one fatty acid chain. It also has a chromatographic profile similar to that of ganoderma lucidum sporocarp extract. Ganoderic acid E exhibits antinociceptive properties in mice when administered intraperitoneally or orally, which may be due to its ability to inhibit the release of neurotransmitters involved in pain sensation (e.g., substance P).
Purity:Min. 95%Color and Shape:SolidGanoderic acid E
CAS:Ganoderic acid F has anti-hepatitis B, anti-inflammatory, and anti-tumor-promoting activities.Formula:C30H40O7Purity:98%Color and Shape:SolidMolecular weight:512.63




