CAS 98665-15-7
:Ganoderic acid F
Description:
Ganoderic acid F is a triterpenoid compound primarily derived from the Ganoderma lucidum mushroom, commonly known as reishi or lingzhi. This compound is part of a larger class of ganoderic acids, which are known for their diverse biological activities. Ganoderic acid F exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects. It is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. The compound is typically studied for its potential health benefits, particularly in traditional medicine, where reishi mushrooms have been used for centuries. Additionally, Ganoderic acid F may influence cholesterol metabolism and immune system modulation. Its solubility properties and stability can vary depending on the solvent and environmental conditions, which is important for its extraction and application in research and potential therapeutic uses. Overall, Ganoderic acid F represents a significant area of interest in natural product chemistry and pharmacology.
Formula:C32H42O9
InChI:InChI=1S/C32H42O9/c1-15(11-18(34)12-16(2)28(39)40)19-13-23(37)32(8)24-20(35)14-21-29(4,5)22(36)9-10-30(21,6)25(24)26(38)27(31(19,32)7)41-17(3)33/h15-16,19,21,27H,9-14H2,1-8H3,(H,39,40)/t15-,16?,19-,21+,27-,30+,31+,32+/m1/s1
InChI key:InChIKey=BWCNWXLKMWWVBT-AIMUVTGPSA-N
SMILES:C[C@@]12[C@](C)([C@H](OC(C)=O)C(=O)C3=C1C(=O)C[C@@]4([C@]3(C)CCC(=O)C4(C)C)[H])[C@@]([C@@H](CC(CC(C(O)=O)C)=O)C)(CC2=O)[H]
Synonyms:- Ganoderic acid F
- (12β)-12-(Acetyloxy)-3,7,11,15,23-pentaoxolanost-8-en-26-oic acid
- Lanost-8-en-26-oic acid, 12-(acetyloxy)-3,7,11,15,23-pentaoxo-, (12β)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ganoderic acid f
CAS:Carboxylic acid with ketone functionFormula:C32H42O9Purity:≥ 85.0 % (HPLC)Molecular weight:570.67Ganoderic acid F
CAS:Controlled ProductGanoderic acid F is a natural product that inhibits the growth of cancer cells. It has been shown to be anti-angiogenic, meaning it prevents the formation of new blood vessels, and displays significant cytotoxicity against cancer cells. Ganoderic acid F is also an inhibitor of fatty acid synthase, which may be related to its cardioprotective effects in vivo. Studies have shown that this compound binds to the receptor for protocatechuic acid and inhibits the activity of enzymes such as lipoxygenase and cyclooxygenase. The structure of ganoderic acid F includes a six-membered ring with two carboxylic acids (protocatechuic and caffeic) and two hydroxyl groups (one at C3).Formula:C32H42O9Purity:Min. 95%Color and Shape:White PowderMolecular weight:570.67 g/molGanoderic acid F
CAS:Ganoderic acid F inhibits the proliferation of HeLa human cervical carcinoma cells with IC(50) values of 19.5+/-0.6 microM.Formula:C32H42O9Purity:99.67%Color and Shape:SolidMolecular weight:570.67





