CAS 98665-17-9
:Lucidenic acid E
Description:
Lucidenic acid E, with the CAS number 98665-17-9, is a triterpenoid compound primarily derived from the medicinal mushroom species Ganoderma lucidum, commonly known as reishi. This compound is characterized by its complex tetracyclic structure, which contributes to its bioactive properties. Lucidenic acid E is known for its potential pharmacological effects, including anti-inflammatory, antioxidant, and immunomodulatory activities. Research suggests that it may play a role in promoting health and wellness, particularly in traditional medicine practices. The compound exhibits solubility in organic solvents, which is typical for many triterpenoids, and its stability can be influenced by environmental factors such as temperature and pH. Additionally, lucidenic acid E has garnered interest in the field of natural product chemistry and pharmacognosy for its therapeutic potential, making it a subject of ongoing scientific investigation. Overall, lucidenic acid E represents a significant area of study within the realm of bioactive natural compounds.
Formula:C29H40O8
InChI:InChI=1S/C29H40O8/c1-14(8-9-21(34)35)16-12-20(33)29(7)22-17(31)13-18-26(3,4)19(32)10-11-27(18,5)23(22)24(36)25(28(16,29)6)37-15(2)30/h14,16,18-19,25,32H,8-13H2,1-7H3,(H,34,35)/t14-,16-,18+,19+,25-,27+,28+,29+/m1/s1
InChI key:InChIKey=ASPCIAWQVXVATP-VWXYMJEFSA-N
SMILES:C[C@@]12[C@](C)(C3=C(C(=O)[C@H]1OC(C)=O)[C@]4(C)[C@@](CC3=O)(C(C)(C)[C@@H](O)CC4)[H])C(=O)C[C@@]2([C@@H](CCC(O)=O)C)[H]
Synonyms:- Chol-8-en-24-oic acid, 12-(acetyloxy)-3-hydroxy-4,4,14-trimethyl-7,11,15-trioxo-, (3β,5α,12β)-
- (3β,5α,12β)-12-(Acetyloxy)-3-hydroxy-4,4,14-trimethyl-7,11,15-trioxochol-8-en-24-oic acid
- Lucidenic acid E 2
- Lucidenic acid E
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Lucidenic acid E
CAS:<p>Lucidenic acid E is a natural product</p>Formula:C29H40O8Purity:98%Color and Shape:SolidMolecular weight:516.62Lucidenic Acid E2
CAS:Controlled Product<p>Lucidenic Acid E2 is a water-soluble compound that can be extracted from medicinal mushrooms. It has been shown to have various pharmacological properties, including antioxidant, anti-inflammatory, and anticancer effects. Lucidenic Acid E2 has been used as a natural alternative to synthetic antioxidants in the food and cosmetic industries. It can also be used as an ingredient in skincare products due to its ability to improve skin elasticity and reduce the appearance of wrinkles. This compound is commonly used in chromatographic studies as a reference standard for the identification of other bioactive compounds. Its synthesis method involves the extraction of lecithin from natural sources followed by purification using techniques such as column chromatography or solid-phase extraction. Lucidenic Acid E2 can be incorporated into controlled-release formulations using polymers or copolymers, which allows for sustained release and enhanced bioavailability. Overall, Lucidenic Acid E2 is a versatile compound with potential applications in medicine, cosmetics, and various other industries.</p>Formula:C29H40O8Purity:Min. 95%Molecular weight:516.63 g/mol
