CAS 98665-18-0

Lucidenic acid F

Description:

Lucidenic acid F, with the CAS number 98665-18-0, is a triterpenoid compound primarily derived from the medicinal mushroom Ganoderma lucidum, commonly known as reishi. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups typical of triterpenes. Lucidenic acid F is noted for its potential pharmacological properties, including anti-inflammatory, antioxidant, and anticancer activities, making it of interest in both traditional medicine and modern pharmacology. Its bioactivity is attributed to its ability to modulate various biological pathways, including those involved in cell proliferation and apoptosis. Additionally, lucidenic acid F may exhibit effects on the immune system, contributing to the overall health benefits associated with Ganoderma lucidum. As research continues, the full spectrum of its therapeutic potential and mechanisms of action is being explored, highlighting the importance of natural products in drug discovery and development.

Formula: C₂₇H₃₆O₆

InChI: InChI=1S/C27H36O6/c1-14(7-8-21(32)33)15-11-20(31)27(6)23-16(28)12-18-24(2,3)19(30)9-10-25(18,4)22(23)17(29)13-26(15,27)5/h14-15,18H,7-13H2,1-6H3,(H,32,33)/t14-,15-,18+,25+,26-,27+/m1/s1

InChI key: InChIKey=GLUXWRYPXYKXKV-FRFVZZROSA-N

SMILES: C[C@]12C3=C([C@]4(C)[C@@](CC3=O)(C(C)(C)C(=O)CC4)[H])C(=O)C[C@]1(C)[C@@]([C@@H](CCC(O)=O)C)(CC2=O)[H]

Synonyms:

• Chol-8-en-24-oic acid, 4,4,14-trimethyl-3,7,11,15-tetraoxo-, (5α)-
• (5α)-4,4,14-Trimethyl-3,7,11,15-tetraoxochol-8-en-24-oic acid
• Lucidenic acid F

Lucidenic Acid F

CAS: 98665-18-0

Formula: C₂₇H₃₆O₆

Purity: 95%~99%

Molecular weight: 456.579

Ref: BP-BP0890

Lucidenic acid F

CAS: 98665-18-0

Lucidenic acid F as a modulator of JNK and p38, it shows potent inhibitory effects on EBV-EA induction.

Formula: C₂₇H₃₆O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 456.57

Ref: TM-TMA1004

Lucidenic acid F

Controlled Product

CAS: 98665-18-0

Lucidenic acid F is a triterpenoid compound, which is an active secondary metabolite derived from the medicinal mushroom Ganoderma lucidum. It exerts its biological effects through several modes of action, primarily by modulating inflammatory pathways and exhibiting antioxidant properties. Notably, Lucidenic acid F has been studied for its ability to inhibit pro-inflammatory cytokines and enhance antioxidant enzyme activities, thus playing a significant role in mitigating oxidative stress and inflammatory responses.

Formula: C₂₇H₃₆O₆

Purity: Min. 95%

Molecular weight: 456.57 g/mol

Ref: 3D-FL74435