CAS 98665-21-5

Ganolucidic acid A

Description:

Ganolucidic acid A, with the CAS number 98665-21-5, is a triterpenoid compound primarily derived from the Ganoderma lucidum fungus, commonly known as reishi mushroom. This compound is characterized by its unique chemical structure, which includes a pentacyclic triterpene framework. Ganolucidic acid A exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. Its solubility profile typically indicates that it is more soluble in organic solvents than in water, which is common for many triterpenoids. Additionally, it may interact with various biological pathways, contributing to its therapeutic potential. The compound's safety and efficacy are subjects of ongoing research, particularly in the context of traditional medicine and modern therapeutic applications. Overall, Ganolucidic acid A represents a significant area of study within natural product chemistry and pharmacognosy, highlighting the importance of fungal metabolites in drug discovery and development.

Formula: C₃₀H₄₄O₆

InChI: InChI=1/C30H44O6/c1-16(12-18(31)13-17(2)26(35)36)20-14-24(34)30(7)19-8-9-22-27(3,4)23(33)10-11-28(22,5)25(19)21(32)15-29(20,30)6/h16-17,20,22,24,34H,8-15H2,1-7H3,(H,35,36)/t16-,17-,20-,22+,24+,28+,29-,30-/m1/s1

InChI key: InChIKey=XRXBNTYHQXKSAO-UHFFFAOYSA-N

SMILES: CC12C3=C(C4(C)C(CC3)C(C)(C)C(=O)CC4)C(=O)CC1(C)C(C(CC(CC(C(O)=O)C)=O)C)CC2O

Synonyms:

• Lanost-8-en-26-oic acid, 15-hydroxy-3,11,23-trioxo-, (15α)-
• (15α)-15-Hydroxy-3,11,23-trioxolanost-8-en-26-oic acid
• Ganolucidic acid A
• (2R,6R)-6-[(5R,10S,13R,14R,15S,17R)-15-hydroxy-4,4,10,13,14-pentamethyl-3,11-dioxo-2,5,6,7,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-4-oxoheptanoic acid
• 15α-Hydroxy-3,11,23-trioxo-5α-lanost-8-en-26-oic acid
• (15alpha,25R)-15-hydroxy-3,11,23-trioxolanost-8-en-26-oic acid

Ganolucidic acid A

CAS: 98665-21-5

Ganolucidic acid A exhibits cytotoxicity, has inhibitory activities against human HeLa cervical cancer cell lines.

Formula: C₃₀H₄₄O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 500.676

Ref: TM-TN4109

Ganolucidic acid A

CAS: 98665-21-5

Ganolucidic acid A is a triterpenoid compound, which is a naturally occurring organic substance primarily isolated from Ganoderma mushrooms, particularly Ganoderma lucidum. These mushrooms have been recognized for their significant medicinal properties throughout history, largely attributed to the complex triterpenoids they produce.

Formula: C₃₀H₄₄O₆

Purity: Min. 95%

Molecular weight: 500.70 g/mol

Ref: 3D-YDA66521