CAS 98665-22-6

Ganoderic acid G

Description:

Ganoderic acid G is a triterpenoid compound primarily derived from the fruiting bodies of the Ganoderma lucidum mushroom, commonly known as reishi. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups, contributing to its biological activity. Ganoderic acid G exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects, making it of interest in medicinal chemistry and natural product research. Its mechanism of action may involve modulation of cellular signaling pathways and inhibition of specific enzymes. Additionally, Ganoderic acid G is known for its ability to enhance immune function, which is a hallmark of reishi mushrooms. The compound is typically studied in the context of traditional medicine and modern therapeutic applications, highlighting its significance in both historical and contemporary health practices. As with many natural products, the extraction and purification processes can influence its bioactivity and efficacy, necessitating careful consideration in research and application.

Formula: C₃₀H₄₄O₈

InChI: InChI=1S/C30H44O8/c1-14(10-16(31)11-15(2)26(37)38)17-12-21(34)30(7)22-18(32)13-19-27(3,4)20(33)8-9-28(19,5)23(22)24(35)25(36)29(17,30)6/h14-15,17-20,25,32-33,36H,8-13H2,1-7H3,(H,37,38)

InChI key: InChIKey=BPJPBLZKOVIJQD-UHFFFAOYSA-N

SMILES: CC12C3=C(C4(C)C(CC3O)C(C)(C)C(O)CC4)C(=O)C(O)C1(C)C(C(CC(CC(C(O)=O)C)=O)C)CC2=O

Synonyms:

• (3β,7β,12β)-3,7,12-Trihydroxy-11,15,23-trioxolanost-8-en-26-oic acid
• Ganoderic acid γ
• Lanost-8-en-26-oic acid, 3,7,12-trihydroxy-11,15,23-trioxo-, (3β,7β,12β)-

Ganoderic acid G

CAS: 98665-22-6

Ganoderic acid G

Purity: ≥98%

Molecular weight: 532.67g/mol

Ref: 54-BUP05117

Ganoderic Acid G

CAS: 98665-22-6

Formula: C₃₀H₄₄O₈

Molecular weight: 532.67

Ref: 7W-GY8453

Ganoderic Acid G

CAS: 98665-22-6

Formula: C₃₀H₄₄O₈

Purity: 95%~99%

Molecular weight: 532.674

Ref: BP-BP0619

Ganoderic acid G

CAS: 98665-22-6

Ganoderic acid G is isolated from the surface of Ganoderma lucidum tube layer.

Formula: C₃₀H₄₄O₈

Purity: 98.83% - 99.86%

Color and Shape: Solid

Molecular weight: 532.67

Ref: TM-T3S1149

Ganoderic acid G

Controlled Product

CAS: 98665-22-6

Ganoderic acid G is a natural compound that has been extracted from the mushroom Ganoderma lucidum. It has been shown to have anticancer, anti-inflammatory, immunomodulatory, and antioxidant properties. Ganoderic acid G inhibits cancer cell proliferation by inhibiting fatty acid synthesis and promoting apoptosis in cancer cells. It also inhibits the production of inflammatory cytokines such as tumor necrosis factor-α (TNF-α). Ganoderic acid G has been found to inhibit the production of reactive oxygen species in human liver cells.

Formula: C₃₀H₄₄O₈

Purity: Min. 95%

Color and Shape: Solid

Molecular weight: 532.67 g/mol

Ref: 3D-FG74207