CAS 98674-80-7
:(2R,4R)-5,5-dime-2-hydroxy-4-phenyl-dio-xaphosphorinan 2-ox.
Description:
The chemical substance known as "(2R,4R)-5,5-dime-2-hydroxy-4-phenyl-dio-xaphosphorinan 2-ox" with the CAS number 98674-80-7 is a phosphorinated compound characterized by its unique structural features, including a phosphorinan ring system. This compound typically exhibits chirality due to the presence of multiple stereocenters, which can influence its reactivity and interaction with biological systems. The hydroxyl group contributes to its potential as a ligand or in coordination chemistry, while the phenyl group may enhance its stability and solubility in organic solvents. Additionally, the presence of phosphorus in its structure suggests potential applications in areas such as catalysis, materials science, or as a precursor in organic synthesis. The specific stereochemistry (2R,4R) indicates that the compound may have distinct physical and chemical properties compared to its stereoisomers, which can be crucial for its functionality in various applications. Overall, this compound represents a complex and potentially versatile chemical entity within the realm of organophosphorus chemistry.
Formula:C11H15O4P
InChI:InChI=1/C11H15O4P/c1-11(2)8-14-16(12,13)15-10(11)9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3,(H,12,13)/t10-/m1/s1
SMILES:CC1(C)COP(=O)(O)O[C@@H]1c1ccccc1
Synonyms:- (R)-(-)-2-hydroxy-5,5-dimethyl-4-phenyl-1,3,2-dio
- (2R,4R)-2-Hydroxy-5,5-dimethyl-4-phenyl-1,3,2-dioxaphosphorinan 2-oxide
- (4R)-5,5-dimethyl-4-phenyl-1,3,2-dioxaphosphinan-2-ol 2-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(4R)-2-Hydroxy-5,5-dimethyl-4-phenyl-1,3,2-dioxaphosphorinan 2-oxide
CAS:Formula:C11H15O4PColor and Shape:SolidMolecular weight:242.2082

