CAS 98674-83-0
:1,3,2-Dioxaphosphorinane, 2-hydroxy-4-(2-methoxyphenyl)-5,5-dimethyl-, 2-oxide, (4S)-
Description:
1,3,2-Dioxaphosphorinane, 2-hydroxy-4-(2-methoxyphenyl)-5,5-dimethyl-, 2-oxide, with CAS number 98674-83-0, is a chemical compound characterized by its unique cyclic structure that incorporates both phosphorus and oxygen atoms. This compound features a dioxaphosphorinane ring, which is a five-membered heterocyclic structure containing two oxygen atoms and one phosphorus atom. The presence of a hydroxy group and a methoxyphenyl substituent contributes to its potential reactivity and solubility properties. The dimethyl groups enhance steric hindrance, which may influence its biological activity and stability. As a phosphorus-containing compound, it may exhibit properties relevant to agricultural chemistry, particularly in the development of pesticides or herbicides. The specific stereochemistry indicated by the (4S) designation suggests a particular spatial arrangement of atoms, which can significantly affect the compound's interactions and efficacy in various applications. Overall, this compound's unique structure and functional groups make it of interest in both synthetic and applied chemistry contexts.
Formula:C12H17O5P
InChI:InChI=1S/C12H17O5P/c1-12(2)8-16-18(13,14)17-11(12)9-6-4-5-7-10(9)15-3/h4-7,11H,8H2,1-3H3,(H,13,14)/t11-/m1/s1
InChI key:InChIKey=HNFXKRNIAWHFJN-LLVKDONJSA-N
SMILES:CC1(C)[C@H](OP(=O)(O)OC1)C2=C(OC)C=CC=C2
Synonyms:- (-)-Anicyphos
- (S)-()-2-Hydroxy-4-(2-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaphosphorinane 2-oxide
- (S)-(-)-4-(2-Methoxyphenyl)-2-hydroxy-5,5-dimethyl-1,3,2-dioxaphosphorinane-2-oxide
- 1,3,2-Dioxaphosphorinane, 2-hydroxy-4-(2-methoxyphenyl)-5,5-dimethyl-, 2-oxide, (4S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(4S)-(-)-5,5-Dimethyl-2-hydroxy-4-(2-methoxyphenyl)-1,3,2-dioxaphosphinane 2-oxide
CAS:<p>(4S)-(-)-5,5-Dimethyl-2-hydroxy-4-(2-methoxyphenyl)-1,3,2-dioxaphosphinane 2-oxide</p>Formula:C12H17O5PPurity:>95% (nmr) (Typical Value in Batch COA)Color and Shape:White SolidMolecular weight:272.23g/mol(S)-(-)-2-Hydroxy-4-(2-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaphosphorinane 2-oxide
CAS:<p>(S)-(-)-2-Hydroxy-4-(2-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaphosphorinane 2-oxide is a crystallization inhibitor. It can be used in the treatment of osteoporosis and to prevent the calcification of prostate tissue. (S)-(-)-2-Hydroxy-4-(2-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaphosphorinane 2-oxide has been shown to inhibit nucleation and crystal growth by adsorbing to the surfaces of nuclei and inhibiting inhibitor molecules from diffusing into the nucleus. This compound also inhibits the crystallization process by binding to one molecule of phosphate on each phosphate site on a crystal surface. The result is that there are fewer sites available for other molecules to bind, preventing crystal growth.</p>Formula:C12H17O5PPurity:Min. 95%Color and Shape:Slightly Yellow PowderMolecular weight:272.23 g/mol


