CymitQuimica logo

CAS 98683-75-1

:

Ganolucidic acid B

Description:
Ganolucidic acid B, with the CAS number 98683-75-1, is a triterpenoid compound primarily derived from certain medicinal plants, particularly those in the Ganoderma genus, such as Ganoderma lucidum, commonly known as reishi mushroom. This compound is characterized by its complex molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. Ganolucidic acid B is noted for its potential pharmacological properties, including anti-inflammatory, antioxidant, and anticancer effects, making it of interest in both traditional medicine and modern pharmacology. Its solubility characteristics may vary, often being more soluble in organic solvents than in water, which influences its extraction and application in various formulations. Research into ganolucidic acid B continues to explore its mechanisms of action and therapeutic potential, particularly in the context of enhancing immune function and combating oxidative stress. As with many natural products, the specific biological effects can depend on the concentration and the presence of other compounds in the extract.
Formula:C30H46O6
InChI:InChI=1S/C30H46O6/c1-16(12-18(31)13-17(2)26(35)36)20-14-24(34)30(7)19-8-9-22-27(3,4)23(33)10-11-28(22,5)25(19)21(32)15-29(20,30)6/h16-17,20,22-24,33-34H,8-15H2,1-7H3,(H,35,36)
InChI key:InChIKey=YPYHGMCHNBTMDB-UHFFFAOYSA-N
SMILES:CC12C3=C(C4(C)C(CC3)C(C)(C)C(O)CC4)C(=O)CC1(C)C(C(CC(CC(C(O)=O)C)=O)C)CC2O
Synonyms:
  • Lanost-8-en-26-oic acid, 3,15-dihydroxy-11,23-dioxo-, (3β,15α)-
  • (3β,15α)-3,15-Dihydroxy-11,23-dioxolanost-8-en-26-oic acid
  • Ganolucidic acid B
  • 3-Hydroxyganolucidic acid A
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.