CymitQuimica logo

CAS 98701-84-9

:

4-(Ethenyloxy)-2,2,6,6-tetramethyl-1-piperidinyloxy

Description:
4-(Ethenyloxy)-2,2,6,6-tetramethyl-1-piperidinyloxy, commonly referred to as a stable free radical, is characterized by its unique structure that includes a piperidine ring substituted with both ethenyloxy and tetramethyl groups. This compound exhibits notable stability due to the presence of the nitroxide functional group, which contributes to its radical properties. It is typically used in various applications, including as a spin label in electron paramagnetic resonance (EPR) spectroscopy and as an antioxidant in polymer chemistry. The ethenyloxy group enhances its reactivity, allowing for potential applications in polymerization processes and as a modifier in materials science. Additionally, the steric bulk provided by the tetramethyl groups helps to stabilize the radical, making it less prone to dimerization or other side reactions. Overall, this compound is significant in both academic research and industrial applications due to its unique radical characteristics and functional versatility.
Formula:C11H20NO2
InChI:InChI=1/C11H20NO2/c1-6-14-9-7-10(2,3)12(13)11(4,5)8-9/h6,9H,1,7-8H2,2-5H3
SMILES:C=COC1CC(C)(C)N(C(C)(C)C1)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.