CAS 98729-72-7
:N-(4-methoxybenzyl)prop-2-yn-1-amine
Description:
N-(4-methoxybenzyl)prop-2-yn-1-amine, with the CAS number 98729-72-7, is an organic compound characterized by its unique structure, which includes a propargyl amine functional group and a methoxy-substituted benzyl moiety. This compound typically exhibits properties associated with both amines and alkynes, such as potential reactivity in nucleophilic substitution and addition reactions. The presence of the methoxy group enhances its solubility in organic solvents and may influence its electronic properties, making it a candidate for various applications in organic synthesis and medicinal chemistry. Additionally, the propargyl amine structure can facilitate the formation of diverse derivatives through further chemical modifications. Its potential biological activity, particularly in relation to its amine functionality, may also be of interest in pharmacological studies. Overall, N-(4-methoxybenzyl)prop-2-yn-1-amine represents a versatile compound with implications in both synthetic and medicinal chemistry contexts.
Formula:C11H13NO
InChI:InChI=1/C11H13NO/c1-3-8-12-9-10-4-6-11(13-2)7-5-10/h1,4-7,12H,8-9H2,2H3
SMILES:C#CCNCc1ccc(cc1)OC
Synonyms:- benzenemethanamine, 4-methoxy-N-2-propyn-1-yl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.