CymitQuimica logo

CAS 98735-79-6

:

4,7-Diazaspiro[2.5]octane-5,8-dione, 6-methyl-, (R)-

Description:
4,7-Diazaspiro[2.5]octane-5,8-dione, 6-methyl-, (R)-, is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework featuring two nitrogen atoms incorporated into the ring system. This compound is a derivative of spiro compounds, which are known for their distinctive three-dimensional arrangements. The presence of the two carbonyl groups (diones) contributes to its reactivity, making it a potential candidate for various chemical transformations. The (R)- designation indicates that the compound has a specific stereochemistry, which can influence its biological activity and interactions with other molecules. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the methyl group at the 6-position can affect the compound's solubility and stability. Overall, 4,7-Diazaspiro[2.5]octane-5,8-dione, 6-methyl-, (R)- is a complex molecule with potential applications in drug development and synthetic chemistry.
Formula:C7H10N2O2
InChI:InChI=1S/C7H10N2O2/c1-4-5(10)9-7(2-3-7)6(11)8-4/h4H,2-3H2,1H3,(H,8,11)(H,9,10)/t4-/m1/s1
InChI key:InChIKey=GOZSGPRARCHOLL-SCSAIBSYSA-N
SMILES:O=C1C2(NC(=O)[C@@H](C)N1)CC2
Synonyms:
  • 4,7-Diazaspiro[2.5]octane-5,8-dione, 6-methyl-, (R)-
  • (6R)-6-Methyl-4,7-diazaspiro[2.5]octane-5,8-dione
  • (R)-6-Methyl-4,7-diazaspiro[2.5]octane-5,8-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.