CymitQuimica logo

CAS 98736-49-3

:

3-{[methyl(nitroso)amino]methyl}benzonitrile

Description:
3-{[Methyl(nitroso)amino]methyl}benzonitrile, with the CAS number 98736-49-3, is a chemical compound characterized by its unique functional groups and structure. It features a benzonitrile backbone, which consists of a benzene ring attached to a nitrile group (-C≡N), contributing to its potential reactivity and applications in organic synthesis. The presence of a methyl(nitroso)amino group indicates that it contains both a nitroso functional group (-NO) and an amino group (-NH2), which can influence its chemical behavior, including its reactivity and potential as a ligand in coordination chemistry. The compound's structure suggests it may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Additionally, the presence of the nitrile group may impart certain physical properties, such as solubility in organic solvents. Overall, 3-{[methyl(nitroso)amino]methyl}benzonitrile is a complex organic molecule with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C9H9N3O
InChI:InChI=1/C9H9N3O/c1-12(11-13)7-9-4-2-3-8(5-9)6-10/h2-5H,7H2,1H3
Synonyms:
  • benzonitrile, 3-[(methylnitrosoamino)methyl]-
  • 3-{[Methyl(nitroso)amino]methyl}benzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.