CAS 98775-19-0
:1-bromo-2-methoxy-3-nitrobenzene
Description:
1-Bromo-2-methoxy-3-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a bromine atom, a methoxy group (-OCH3), and a nitro group (-NO2) attached to a benzene ring. This compound is typically a yellow to brown solid at room temperature and is known for its moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water due to its hydrophobic aromatic nature. The presence of the nitro group contributes to its electron-withdrawing properties, influencing its reactivity and making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the methoxy group can act as an electron-donating substituent, affecting the compound's overall electronic properties. 1-Bromo-2-methoxy-3-nitrobenzene is utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. As with many brominated compounds, it is important to handle it with care due to potential toxicity and environmental concerns.
Formula:C7H6BrNO3
InChI:InChI=1/C7H6BrNO3/c1-12-7-5(8)3-2-4-6(7)9(10)11/h2-4H,1H3
SMILES:COc1c(cccc1N(=O)=O)Br
Synonyms:- 3-Bromo-4-methoxy-5-nitropyridine
- 1-Bromo-2-Methoxy-3-Nitro Benzene
- 2-Bromo-6-nitroanisole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Bromo-2-methoxy-3-nitrobenzene
CAS:Formula:C7H6BrNO3Purity:98%Color and Shape:SolidMolecular weight:232.0314Ref: IN-DA003E3B
1g26.00€5g26.00€10g25.00€25g47.00€50g62.00€100g114.00€10kgTo inquire250g164.00€500g312.00€250mg20.00€2-Bromo-6-nitroanisole
CAS:2-Bromo-6-nitroanisoleFormula:C7H6BrNO3Purity:≥95%Color and Shape: faint orange to light yellow crystalline solidMolecular weight:232.03g/mol1-Bromo-2-methoxy-3-nitrobenzene
CAS:1-Bromo-2-methoxy-3-nitrobenzene is a high quality chemical that is used as a reagent and building block in organic synthesis. It is also a versatile intermediate and can be used in the synthesis of complex compounds. This chemical has been shown to have anti-inflammatory properties, which may be due to its inhibition of prostaglandin synthesis.Formula:C7H6BrNO3Purity:Min. 95%Color and Shape:PowderMolecular weight:232.03 g/mol1-Bromo-2-methoxy-3-nitrobenzene
CAS:Formula:C7H6BrNO3Purity:95%Color and Shape:SolidMolecular weight:232.033




