CAS 98797-08-1
:5-Amino-6-hydroxy-2-methyl-4(3H)-pyrimidinone
Description:
5-Amino-6-hydroxy-2-methyl-4(3H)-pyrimidinone, with the CAS number 98797-08-1, is a pyrimidine derivative characterized by the presence of amino and hydroxy functional groups. This compound typically exhibits a solid state at room temperature and is soluble in polar solvents due to its hydrophilic groups. The amino group contributes to its basicity, while the hydroxy group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. It is often studied for its potential biological activities, including roles in nucleic acid metabolism and as a precursor in the synthesis of various pharmaceuticals. The molecular structure features a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms, contributing to its stability and reactivity. Overall, this compound is of interest in medicinal chemistry and biochemistry for its potential applications in drug development and as a biochemical tool.
Formula:C5H7N3O2
InChI:InChI=1S/C5H7N3O2/c1-2-7-4(9)3(6)5(10)8-2/h6H2,1H3,(H2,7,8,9,10)
InChI key:InChIKey=YICLTNFWMVEECR-UHFFFAOYSA-N
SMILES:NC=1C(=O)NC(C)=NC1O
Synonyms:- 4(1H)-Pyrimidinone, 5-amino-6-hydroxy-2-methyl-
- 4(1H)-Pyrimidinone,5-amino-6-hydroxy-2-methyl- (9CI)
- 5-Amino-2-methylpyrimidine-4,6-diol
- 5-Amino-6-hydroxy-2-methyl-4(3H)-pyrimidinone
- 4(3H)-Pyrimidinone, 5-amino-6-hydroxy-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.