CAS 98799-36-1

3-methoxy-4-(1-methylethoxy)benzaldehyde oxime

Description:

3-Methoxy-4-(1-methylethoxy)benzaldehyde oxime, with the CAS number 98799-36-1, is an organic compound characterized by its oxime functional group, which is derived from the corresponding aldehyde. This compound features a benzaldehyde moiety substituted with a methoxy group and an ethoxy group, contributing to its unique chemical properties. The presence of the oxime functional group indicates that it can participate in various chemical reactions, such as condensation and rearrangement, making it useful in synthetic organic chemistry. The methoxy and ethoxy substituents enhance its solubility in organic solvents and may influence its reactivity and stability. Additionally, compounds like this can exhibit interesting biological activities, making them of interest in medicinal chemistry. Its structural features suggest potential applications in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its concentration and exposure levels.

Formula: C₁₁H₁₅NO₃

InChI: InChI=1/C11H15NO3/c1-8(2)15-10-5-4-9(7-12-13)6-11(10)14-3/h4-8,13H,1-3H3/b12-7-

SMILES: CC(C)Oc1ccc(cc1OC)/C=N\O

4-Isopropoxy-3-methoxybenzaldehyde oxime

CAS: 98799-36-1

Versatile small molecule scaffold

Formula: C₁₁H₁₅NO₃

Purity: Min. 95%

Molecular weight: 209.25 g/mol

Ref: 3D-YDA79936