CAS 98806-82-7
:sulforhodamine B 2-acid fluoride
Description:
Sulforhodamine B 2-acid fluoride, identified by its CAS number 98806-82-7, is a synthetic dye and a derivative of sulforhodamine B, which is widely used in biological and chemical applications. This compound is characterized by its vibrant pink to red color, making it useful as a fluorescent marker in various assays, particularly in cell biology and biochemistry. It exhibits strong absorbance and fluorescence properties, allowing for effective visualization in microscopy and flow cytometry. The presence of the acid fluoride group enhances its reactivity, making it suitable for conjugation with other biomolecules. Sulforhodamine B 2-acid fluoride is soluble in water and organic solvents, which facilitates its application in diverse experimental conditions. Additionally, it is important to handle this compound with care, as it may pose health risks if ingested or inhaled, and appropriate safety measures should be taken during its use in laboratory settings. Overall, its unique properties make it a valuable tool in scientific research, particularly in studies involving cellular processes and molecular interactions.
Formula:C27H29FN2O6S2
InChI:InChI=1/C27H29FN2O6S2/c1-5-29(6-2)18-9-12-21-24(15-18)36-25-16-19(30(7-3)8-4)10-13-22(25)27(21)23-14-11-20(38(33,34)35)17-26(23)37(28,31)32/h9-17H,5-8H2,1-4H3
SMILES:CCN(CC)c1ccc2c(c1)[o+]c1cc(ccc1c2c1ccc(cc1S(=O)(=O)F)[S-](=O)(=O)=O)N(CC)CC
Synonyms:- 4-[6-(diethylamino)-3-(diethyliminio)-3H-xanthen-9-yl]-3-(fluorosulfonyl)benzenesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.