CAS 98813-13-9
:(3E,5E,7R,8S,9S,11E,13E,15S,16R)-16-[(1S,2R,3S,5E,7S,8R)-2,8-dihydroxy-1,3,7,9-tetramethyl-4-oxodec-5-en-1-yl]-8-hydroxy-3,15-dimethoxy-5,7,9,11-tetramethyloxacyclohexadeca-3,5,11,13-tetraen-2-one
Description:
The chemical substance with the name "(3E,5E,7R,8S,9S,11E,13E,15S,16R)-16-[(1S,2R,3S,5E,7S,8R)-2,8-dihydroxy-1,3,7,9-tetramethyl-4-oxodec-5-en-1-yl]-8-hydroxy-3,15-dimethoxy-5,7,9,11-tetramethyloxacyclohexadeca-3,5,11,13-tetraen-2-one" and CAS number "98813-13-9" is a complex organic compound characterized by multiple stereocenters and a series of functional groups, including hydroxyl (-OH) and methoxy (-OCH3) groups. This compound exhibits a polycyclic structure, which contributes to its potential biological activity. The presence of multiple double bonds indicates that it may participate in various chemical reactions, including oxidation and reduction processes. Its stereochemistry suggests specific spatial arrangements that could influence its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's intricate structure may confer unique physical properties, such as solubility and stability, which are essential for its application in pharmaceuticals or natural product chemistry. Overall, this substance exemplifies the complexity often found in bioactive natural products.
Formula:C35H56O8
InChI:InChI=1/C35H56O8/c1-20(2)31(37)23(5)15-16-28(36)26(8)33(39)27(9)34-29(41-10)14-12-13-21(3)17-24(6)32(38)25(7)18-22(4)19-30(42-11)35(40)43-34/h12-16,18-20,23-27,29,31-34,37-39H,17H2,1-11H3/b14-12+,16-15+,21-13+,22-18+,30-19+/t23-,24-,25+,26+,27-,29-,31+,32-,33-,34+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

