CAS 98816-24-1
:3-chloro-5-(thiophen-2-ylsulfanyl)-1,2,4-thiadiazole
Description:
3-Chloro-5-(thiophen-2-ylsulfanyl)-1,2,4-thiadiazole is a heterocyclic compound characterized by the presence of a thiadiazole ring, which contains nitrogen and sulfur atoms, contributing to its unique chemical properties. The compound features a chlorine substituent at the 3-position and a thiophenylsulfanyl group at the 5-position, enhancing its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the thiophenyl group may impart additional electronic and steric effects, influencing the compound's behavior in chemical reactions. This compound is likely to exhibit moderate to high solubility in organic solvents, while its stability can be affected by environmental factors such as light and moisture. Its structure suggests potential biological activity, making it a candidate for further research in medicinal chemistry. Overall, 3-chloro-5-(thiophen-2-ylsulfanyl)-1,2,4-thiadiazole is a versatile compound with interesting chemical characteristics that warrant exploration for various applications.
Formula:C6H3ClN2S3
InChI:InChI=1/C6H3ClN2S3/c7-5-8-6(12-9-5)11-4-2-1-3-10-4/h1-3H
SMILES:c1cc(sc1)Sc1nc(Cl)ns1
Synonyms:- 1,2,4-Thiadiazole, 3-chloro-5-(2-thienylthio)-
- 3-Chloro-5-(2-thienylsulfanyl)-1,2,4-thiadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
