CymitQuimica logo

CAS 98816-61-6

:

4-bromo-N,N-diisopropylbenzylamine

Description:
4-Bromo-N,N-diisopropylbenzylamine is an organic compound characterized by its structure, which includes a benzylamine core substituted with a bromine atom at the para position and two isopropyl groups attached to the nitrogen atom. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It exhibits properties common to amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the bromine atom introduces electrophilic characteristics, making it a potential candidate for further chemical reactions, such as nucleophilic substitutions. Additionally, the diisopropyl groups contribute to steric hindrance, which can affect the reactivity and interaction of the molecule with other chemical species. This compound may be of interest in synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential biological activity. Safety precautions should be observed when handling this compound, as with many amines and halogenated compounds.
Formula:C13H20BrN
InChI:InChI=1/C13H20BrN/c1-10(2)15(11(3)4)9-12-5-7-13(14)8-6-12/h5-8,10-11H,9H2,1-4H3
SMILES:CC(C)N(Cc1ccc(cc1)Br)C(C)C
Synonyms:
  • N-(4-bromobenzyl)-N-(propan-2-yl)propan-2-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.